CAS 1809158-19-7 appears in our catalog under these names: 4-Benzyloxy-2-(trifluoromethoxy)benzaldehyde, 95%, 4-Benzyloxy-2-(trifluoromethoxy)benzaldehyde. Offered by: Combi-blocks, Fluorochem. Available pack sizes: 10g, 5g, 1g, 250mg.
4-phenylmethoxy-2-(trifluoromethoxy)benzaldehyde (CAS 1809158-19-7) is a chemical compound with the molecular formula C15H11F3O3 and a molecular weight of 296.24 g/mol. IUPAC name: 4-phenylmethoxy-2-(trifluoromethoxy)benzaldehyde. InChIKey: AWIOAXGWNPTNFN-UHFFFAOYSA-N.
| Molecular formula | C15H11F3O3 |
|---|---|
| Molecular weight | 296.24 g/mol |
| IUPAC name | 4-phenylmethoxy-2-(trifluoromethoxy)benzaldehyde |
| InChIKey | AWIOAXGWNPTNFN-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)COC2=CC(=C(C=C2)C=O)OC(F)(F)F |
Computed by PubChem (NCBI)