Products 2379322-71-9
CAS 2379322-71-9 appears in our catalog under these names: Methyl 4-(trifluoromethoxy)-[1,1'-biphenyl]-2-carboxylate, 95%, Methyl 4-(trifluoromethoxy)-[1,1'-biphenyl]-2-carboxylate. Offered by: Combi-blocks, Fluorochem. Available pack sizes: 10g, 5g, 1g, 250mg.
Methyl 2-phenyl-5-(trifluoromethoxy)benzoate (CAS 2379322-71-9) is a chemical compound with the molecular formula C15H11F3O3 and a molecular weight of 296.24 g/mol. IUPAC name: methyl 2-phenyl-5-(trifluoromethoxy)benzoate. InChIKey: BEVUMZBHJVZMKF-UHFFFAOYSA-N.
| Molecular formula | C15H11F3O3 |
|---|---|
| Molecular weight | 296.24 g/mol |
| IUPAC name | methyl 2-phenyl-5-(trifluoromethoxy)benzoate |
| InChIKey | BEVUMZBHJVZMKF-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=C(C=CC(=C1)OC(F)(F)F)C2=CC=CC=C2 |
Computed by PubChem (NCBI)