CAS 946007-74-5 is the registry number for 3-(Benzyloxy)-4-(trifluoromethyl)benzoic acid, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 5g.
3-phenylmethoxy-4-(trifluoromethyl)benzoic acid (CAS 946007-74-5) is a chemical compound with the molecular formula C15H11F3O3 and a molecular weight of 296.24 g/mol. IUPAC name: 3-phenylmethoxy-4-(trifluoromethyl)benzoic acid. InChIKey: ZCSLOOFJVWUBNH-UHFFFAOYSA-N.
| Molecular formula | C15H11F3O3 |
|---|---|
| Molecular weight | 296.24 g/mol |
| IUPAC name | 3-phenylmethoxy-4-(trifluoromethyl)benzoic acid |
| InChIKey | ZCSLOOFJVWUBNH-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)COC2=C(C=CC(=C2)C(=O)O)C(F)(F)F |
Computed by PubChem (NCBI)