CAS 180923-78-8 appears in our catalog under these names: (2S)-2-(1-Oxo-2,3-dihydro-1H-isoindol-2-yl)propanoic acid, 95%, (2S)-2-(1-Oxo-2,3-dihydro-1H-isoindol-2-yl)propanoic acid. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 100mg, 250mg, 2,5g.
(2S)-2-(3-oxo-1H-isoindol-2-yl)propanoic acid (CAS 180923-78-8) is a chemical compound with the molecular formula C11H11NO3 and a molecular weight of 205.21 g/mol. IUPAC name: (2S)-2-(3-oxo-1H-isoindol-2-yl)propanoic acid. InChIKey: XBPWPQBDGZFHQI-ZETCQYMHSA-N.
| Molecular formula | C11H11NO3 |
|---|---|
| Molecular weight | 205.21 g/mol |
| IUPAC name | (2S)-2-(3-oxo-1H-isoindol-2-yl)propanoic acid |
| InChIKey | XBPWPQBDGZFHQI-ZETCQYMHSA-N |
| SMILES | C[C@@H](C(=O)O)N1CC2=CC=CC=C2C1=O |
Computed by PubChem (NCBI)