Products 298700-67-1
CAS 298700-67-1 is the registry number for (2R)-2-(1-Oxo-2,3-dihydro-1H-isoindol-2-yl)propanoic acid. Offered by: Biosynth. Available pack sizes: 0,5g, 5g.
(2R)-2-(3-oxo-1H-isoindol-2-yl)propanoic acid (CAS 298700-67-1) is a chemical compound with the molecular formula C11H11NO3 and a molecular weight of 205.21 g/mol. IUPAC name: (2R)-2-(3-oxo-1H-isoindol-2-yl)propanoic acid. InChIKey: XBPWPQBDGZFHQI-SSDOTTSWSA-N.
| Molecular formula | C11H11NO3 |
|---|---|
| Molecular weight | 205.21 g/mol |
| IUPAC name | (2R)-2-(3-oxo-1H-isoindol-2-yl)propanoic acid |
| InChIKey | XBPWPQBDGZFHQI-SSDOTTSWSA-N |
| SMILES | C[C@H](C(=O)O)N1CC2=CC=CC=C2C1=O |
Computed by PubChem (NCBI)