Products 1809298-92-7
CAS 1809298-92-7 is the registry number for 2-(2,3-Difluoro-4-methoxyphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane. Offered by: Biosynth. Available pack sizes: 500mg, 250mg, 1000mg, 5000mg.
2-(2,3-difluoro-4-methoxyphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (CAS 1809298-92-7) is a chemical compound with the molecular formula C13H17BF2O3 and a molecular weight of 270.08 g/mol. IUPAC name: 2-(2,3-difluoro-4-methoxyphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane. InChIKey: JXWUYLPPCSJQCW-UHFFFAOYSA-N.
| Molecular formula | C13H17BF2O3 |
|---|---|
| Molecular weight | 270.08 g/mol |
| IUPAC name | 2-(2,3-difluoro-4-methoxyphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| InChIKey | JXWUYLPPCSJQCW-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=C(C(=C(C=C2)OC)F)F |
Computed by PubChem (NCBI)