Products 1809337-22-1
CAS 1809337-22-1 appears in our catalog under these names: Methyl 3,4-dihydroxy-2,5-dimethylbenzoate, 95%, Methyl 3,4-dihydroxy-2,5-dimethylbenzoate, 95+%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 5g, 1g, 10g.
Methyl 3,4-dihydroxy-2,5-dimethylbenzoate (CAS 1809337-22-1) is a chemical compound with the molecular formula C10H12O4 and a molecular weight of 196.20 g/mol. IUPAC name: methyl 3,4-dihydroxy-2,5-dimethylbenzoate. InChIKey: QAKMMJACUDPNME-UHFFFAOYSA-N.
| Molecular formula | C10H12O4 |
|---|---|
| Molecular weight | 196.20 g/mol |
| IUPAC name | methyl 3,4-dihydroxy-2,5-dimethylbenzoate |
| InChIKey | QAKMMJACUDPNME-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C(=C1O)O)C)C(=O)OC |
Computed by PubChem (NCBI)