Products 1809417-32-0

CAS 1809417-32-0 is the registry number for 2-Methoxy-5-methyl-1,1':2',1''-terphenyl, 95-<97%. Offered by: Hoffman Fine Chemicals. Available pack sizes: 2,5g, 5g, 10g, 25g.

Structural formula: {0} (CAS {1})

1-methoxy-4-methyl-2-(2-phenylphenyl)benzene (CAS 1809417-32-0) is a chemical compound with the molecular formula C20H18O and a molecular weight of 274.4 g/mol. IUPAC name: 1-methoxy-4-methyl-2-(2-phenylphenyl)benzene. InChIKey: OVLIOTUMJINDSL-UHFFFAOYSA-N.

Identity
Molecular formulaC20H18O
Molecular weight274.4 g/mol
IUPAC name1-methoxy-4-methyl-2-(2-phenylphenyl)benzene
InChIKeyOVLIOTUMJINDSL-UHFFFAOYSA-N
SMILESCC1=CC(=C(C=C1)OC)C2=CC=CC=C2C3=CC=CC=C3

Computed by PubChem (NCBI)