CAS 2234872-71-8 appears in our catalog under these names: Tazobactam Impurity T, Tazobactam Acid Impurity 39. Offered by: Chemat Brand. Available pack sizes: on request.
2-benzhydryl-3-methylphenol (CAS 2234872-71-8) is a chemical compound with the molecular formula C20H18O and a molecular weight of 274.4 g/mol. IUPAC name: 2-benzhydryl-3-methylphenol. InChIKey: OQXSYZKARIGIGQ-UHFFFAOYSA-N.
| Molecular formula | C20H18O |
|---|---|
| Molecular weight | 274.4 g/mol |
| IUPAC name | 2-benzhydryl-3-methylphenol |
| InChIKey | OQXSYZKARIGIGQ-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=CC=C1)O)C(C2=CC=CC=C2)C3=CC=CC=C3 |
Computed by PubChem (NCBI)