CAS 596-31-6 appears in our catalog under these names: Methyl triphenylmethyl ether, 95%, Olmesartan Impurity 3 (Methyl Triphenylmethyl Ether), Methyl Triphenylmethyl Ether, >95% (HPLC), 1,1′,1′′-(Methoxymethanetriyl)tribenzene (Methyl Trityl Ether), METHYL TRIPHENYLMETHYL ETHER, >=97.0%. Offered by: Combi-blocks, Chemat Brand, TRC, Mikromol, Sigma-Aldrich. Available pack sizes: 5g, on request, 100mg, 50mg, 25mg, 250mg, 1g.
[methoxy(diphenyl)methyl]benzene (CAS 596-31-6) is a chemical compound with the molecular formula C20H18O and a molecular weight of 274.4 g/mol. IUPAC name: [methoxy(diphenyl)methyl]benzene. InChIKey: IRMNIXXVOOMKKP-UHFFFAOYSA-N.
| Molecular formula | C20H18O |
|---|---|
| Molecular weight | 274.4 g/mol |
| IUPAC name | [methoxy(diphenyl)methyl]benzene |
| InChIKey | IRMNIXXVOOMKKP-UHFFFAOYSA-N |
| SMILES | COC(C1=CC=CC=C1)(C2=CC=CC=C2)C3=CC=CC=C3 |
Computed by PubChem (NCBI)