CAS 1809946-58-4 appears in our catalog under these names: 2-(4-Bromo-3-chlorophenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane, 95%, 2-(4-Bromo-3-chlorophenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane, 98%. Offered by: Combi-blocks, Fluorochem. Available pack sizes: 5g, 10g, 25g, 1g, 250mg.
2-(4-bromo-3-chlorophenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (CAS 1809946-58-4) is a chemical compound with the molecular formula C12H15BBrClO2 and a molecular weight of 317.41 g/mol. IUPAC name: 2-(4-bromo-3-chlorophenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane. InChIKey: ZQWBLKHLGWZXNW-UHFFFAOYSA-N.
| Molecular formula | C12H15BBrClO2 |
|---|---|
| Molecular weight | 317.41 g/mol |
| IUPAC name | 2-(4-bromo-3-chlorophenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| InChIKey | ZQWBLKHLGWZXNW-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=C(C=C2)Br)Cl |
Computed by PubChem (NCBI)