CAS 2121512-35-2 appears in our catalog under these names: 2-(2-Bromo-6-chlorophenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane 97%, 2-Bromo-6-chlorophenylboronic acid pinacol ester, 2-Bromo-6-chlorophenylboronic acid pinacol ester, 95%. Offered by: Ambeed, Fluorochem, Combi-blocks. Available pack sizes: 250mg, 1g, 5g, 10g, 25g, 100g.
2-(2-bromo-6-chlorophenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (CAS 2121512-35-2) is a chemical compound with the molecular formula C12H15BBrClO2 and a molecular weight of 317.41 g/mol. IUPAC name: 2-(2-bromo-6-chlorophenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane. InChIKey: DLQOZPQKJXCYSY-UHFFFAOYSA-N.
| Molecular formula | C12H15BBrClO2 |
|---|---|
| Molecular weight | 317.41 g/mol |
| IUPAC name | 2-(2-bromo-6-chlorophenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| InChIKey | DLQOZPQKJXCYSY-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=C(C=CC=C2Br)Cl |
Computed by PubChem (NCBI)