CAS 2409835-64-7 appears in our catalog under these names: 3-Bromo-2-chlorophenylboronic acid pinacol ester, 95%, 2-(3-Bromo-2-chlorophenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane, 97%, 97%. Offered by: Combi-blocks, Chemat. Available pack sizes: 250mg, 5g, 1g, 100mg.
2-(3-bromo-2-chlorophenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (CAS 2409835-64-7) is a chemical compound with the molecular formula C12H15BBrClO2 and a molecular weight of 317.41 g/mol. IUPAC name: 2-(3-bromo-2-chlorophenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane. InChIKey: BULSRLAASYCZHJ-UHFFFAOYSA-N.
| Molecular formula | C12H15BBrClO2 |
|---|---|
| Molecular weight | 317.41 g/mol |
| IUPAC name | 2-(3-bromo-2-chlorophenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| InChIKey | BULSRLAASYCZHJ-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=C(C(=CC=C2)Br)Cl |
Computed by PubChem (NCBI)