Products 1809980-22-0
CAS 1809980-22-0 appears in our catalog under these names: (R)-4-Methoxy-1,5,8-trimethyl-8,9-dihydronaphtho[2,1-b]furan-6(7H)-one, ≥98%, ≥98%, 9-Methoxymyrrhone, 99.56%. Offered by: Chemat, MedChemExpress. Available pack sizes: 10mg, 20mg, 50mg, 100mg, 5 mg, 1 mg.
(8R)-4-methoxy-1,5,8-trimethyl-8,9-dihydro-7H-benzo[e][1]benzofuran-6-one (CAS 1809980-22-0) is a chemical compound with the molecular formula C16H18O3 and a molecular weight of 258.31 g/mol. IUPAC name: (8R)-4-methoxy-1,5,8-trimethyl-8,9-dihydro-7H-benzo[e][1]benzofuran-6-one. InChIKey: YRLDTAQTJKXXFC-MRVPVSSYSA-N.
| Molecular formula | C16H18O3 |
|---|---|
| Molecular weight | 258.31 g/mol |
| IUPAC name | (8R)-4-methoxy-1,5,8-trimethyl-8,9-dihydro-7H-benzo[e][1]benzofuran-6-one |
| InChIKey | YRLDTAQTJKXXFC-MRVPVSSYSA-N |
| SMILES | C[C@@H]1CC2=C3C(=COC3=C(C(=C2C(=O)C1)C)OC)C |
Computed by PubChem (NCBI)