CAS 1810-78-2 is the registry number for 2,2,4,6-Tetramethyl-1,2-dihydroquinoline 98%. Offered by: Ambeed. Available pack sizes: 25mg, 50mg, 100mg, 250mg, 1g.
2,2,4,6-tetramethyl-1H-quinoline (CAS 1810-78-2) is a chemical compound with the molecular formula C13H17N and a molecular weight of 187.28 g/mol. IUPAC name: 2,2,4,6-tetramethyl-1H-quinoline. InChIKey: DTMCOYOYXVFCKJ-UHFFFAOYSA-N.
| Molecular formula | C13H17N |
|---|---|
| Molecular weight | 187.28 g/mol |
| IUPAC name | 2,2,4,6-tetramethyl-1H-quinoline |
| InChIKey | DTMCOYOYXVFCKJ-UHFFFAOYSA-N |
| SMILES | CC1=CC2=C(C=C1)NC(C=C2C)(C)C |
Computed by PubChem (NCBI)