CAS 1810074-71-5 appears in our catalog under these names: (S)-2-(Methylamino)-2-phenylethanol hydrochloride, 95%, (S)–2–(Methylamino)–2–phenylethanol hydrochloride. Offered by: Combi-blocks, GLPBio. Available pack sizes: 1g, 100mg, 250mg.
(2S)-2-(methylamino)-2-phenylethanol;hydrochloride (CAS 1810074-71-5) is a chemical compound with the molecular formula C9H14ClNO and a molecular weight of 187.66 g/mol. IUPAC name: (2S)-2-(methylamino)-2-phenylethanol;hydrochloride. InChIKey: PUYJUPCZJUYIKT-SBSPUUFOSA-N.
| Molecular formula | C9H14ClNO |
|---|---|
| Molecular weight | 187.66 g/mol |
| IUPAC name | (2S)-2-(methylamino)-2-phenylethanol;hydrochloride |
| InChIKey | PUYJUPCZJUYIKT-SBSPUUFOSA-N |
| SMILES | CN[C@H](CO)C1=CC=CC=C1.Cl |
Computed by PubChem (NCBI)