CAS 1810074-74-8 appears in our catalog under these names: (S)-1-(5-Methylfuran-2-yl)propan-1-amine hydrochloride, 95%, (S)-1-(5-Methylfuran-2-yl)propan-1-amine hydrochloride, 95%, 95%, (S)-1-(5-METHYLFURAN-2-YL)PROPAN-1-AMINE HCL, 95%. Offered by: Combi-blocks, Chemat, Fluorochem. Available pack sizes: 1g, 250mg, 5g.
(1S)-1-(5-methylfuran-2-yl)propan-1-amine;hydrochloride (CAS 1810074-74-8) is a chemical compound with the molecular formula C8H14ClNO and a molecular weight of 175.65 g/mol. IUPAC name: (1S)-1-(5-methylfuran-2-yl)propan-1-amine;hydrochloride. InChIKey: URFQDTRFLKESTD-FJXQXJEOSA-N.
| Molecular formula | C8H14ClNO |
|---|---|
| Molecular weight | 175.65 g/mol |
| IUPAC name | (1S)-1-(5-methylfuran-2-yl)propan-1-amine;hydrochloride |
| InChIKey | URFQDTRFLKESTD-FJXQXJEOSA-N |
| SMILES | CC[C@@H](C1=CC=C(O1)C)N.Cl |
Computed by PubChem (NCBI)