CAS 205639-90-3 appears in our catalog under these names: Diendo-(3-amino-bicyclo[2.2.1]hept-5-en-2-yl)-methanol hydrochloride, 95%, Diendo-(3-amino-bicyclo(2.2.1)hept-5-en-2-yl)-methanol hydrochloride, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 1g, 5g.
[(1S,2R,3S,4R)-3-amino-2-bicyclo[2.2.1]hept-5-enyl]methanol;hydrochloride (CAS 205639-90-3) is a chemical compound with the molecular formula C8H14ClNO and a molecular weight of 175.65 g/mol. IUPAC name: [(1S,2R,3S,4R)-3-amino-2-bicyclo[2.2.1]hept-5-enyl]methanol;hydrochloride. InChIKey: VIAVFZWOASZJFH-ICDZOTBQSA-N.
| Molecular formula | C8H14ClNO |
|---|---|
| Molecular weight | 175.65 g/mol |
| IUPAC name | [(1S,2R,3S,4R)-3-amino-2-bicyclo[2.2.1]hept-5-enyl]methanol;hydrochloride |
| InChIKey | VIAVFZWOASZJFH-ICDZOTBQSA-N |
| SMILES | C1[C@H]2C=C[C@@H]1[C@@H]([C@@H]2CO)N.Cl |
Computed by PubChem (NCBI)