CAS 779340-50-0 appears in our catalog under these names: (R)-1-(5-Methylfuran-2-yl)propan-1-amine hydrochloride, 95%, (R)–1–(5–Methylfuran–2–yl)propan–1–amine hydrochloride, 2-Furanmethanamine, α-ethyl-5-methyl-, hydrochloride (1:1), (αR)-, 98%, 98%, (R)-1-(5-Methylfuran-2-yl)propan-1-amine hydrochloride, 98%. Offered by: Combi-blocks, GLPBio, Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 100mg.
(1R)-1-(5-methylfuran-2-yl)propan-1-amine;hydrochloride (CAS 779340-50-0) is a chemical compound with the molecular formula C8H14ClNO and a molecular weight of 175.65 g/mol. IUPAC name: (1R)-1-(5-methylfuran-2-yl)propan-1-amine;hydrochloride. InChIKey: URFQDTRFLKESTD-OGFXRTJISA-N.
| Molecular formula | C8H14ClNO |
|---|---|
| Molecular weight | 175.65 g/mol |
| IUPAC name | (1R)-1-(5-methylfuran-2-yl)propan-1-amine;hydrochloride |
| InChIKey | URFQDTRFLKESTD-OGFXRTJISA-N |
| SMILES | CC[C@H](C1=CC=C(O1)C)N.Cl |
Computed by PubChem (NCBI)