CAS 181052-88-0 is the registry number for 7-Methoxy-2-methyl-2,3-dihydro-1-benzofuran-3-one. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
7-methoxy-2-methyl-1-benzofuran-3-one (CAS 181052-88-0) is a chemical compound with the molecular formula C10H10O3 and a molecular weight of 178.18 g/mol. IUPAC name: 7-methoxy-2-methyl-1-benzofuran-3-one. InChIKey: KKAQANLUERRIRW-UHFFFAOYSA-N.
| Molecular formula | C10H10O3 |
|---|---|
| Molecular weight | 178.18 g/mol |
| IUPAC name | 7-methoxy-2-methyl-1-benzofuran-3-one |
| InChIKey | KKAQANLUERRIRW-UHFFFAOYSA-N |
| SMILES | CC1C(=O)C2=C(O1)C(=CC=C2)OC |
Computed by PubChem (NCBI)