CAS 181070-25-7 appears in our catalog under these names: 1,3-Benzothiazole-2,6-diamine dihydrochloride, 95%, 1,3-Benzothiazole-2,6-diamine dihydrochloride. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 10g, 1g, 250mg, 5g.
1,3-benzothiazole-2,6-diamine;dihydrochloride (CAS 181070-25-7) is a chemical compound with the molecular formula C7H9Cl2N3S and a molecular weight of 238.14 g/mol. IUPAC name: 1,3-benzothiazole-2,6-diamine;dihydrochloride. InChIKey: VJCSNAYBQVVCAX-UHFFFAOYSA-N.
| Molecular formula | C7H9Cl2N3S |
|---|---|
| Molecular weight | 238.14 g/mol |
| IUPAC name | 1,3-benzothiazole-2,6-diamine;dihydrochloride |
| InChIKey | VJCSNAYBQVVCAX-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1N)SC(=N2)N.Cl.Cl |
Computed by PubChem (NCBI)