CAS 2305622-57-3 is the registry number for 6-Hydrazinyl-1,3-benzothiazole dihydrochloride. Offered by: Biosynth. Available pack sizes: 50mg.
1,3-benzothiazol-6-ylhydrazine;dihydrochloride (CAS 2305622-57-3) is a chemical compound with the molecular formula C7H9Cl2N3S and a molecular weight of 238.14 g/mol. IUPAC name: 1,3-benzothiazol-6-ylhydrazine;dihydrochloride. InChIKey: BMSQPGVBQGNEJT-UHFFFAOYSA-N.
| Molecular formula | C7H9Cl2N3S |
|---|---|
| Molecular weight | 238.14 g/mol |
| IUPAC name | 1,3-benzothiazol-6-ylhydrazine;dihydrochloride |
| InChIKey | BMSQPGVBQGNEJT-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1NN)SC=N2.Cl.Cl |
Computed by PubChem (NCBI)