CAS 2044835-56-3 appears in our catalog under these names: Thiazolo(4,5-c)pyridin-2-ylmethanamine dihydrochloride, 98%, {(1,3)Thiazolo(4,5-c)pyridin-2-yl}methanamine dihydrochloride. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 50mg, 0,5g.
[1,3]thiazolo[4,5-c]pyridin-2-ylmethanamine;dihydrochloride (CAS 2044835-56-3) is a chemical compound with the molecular formula C7H9Cl2N3S and a molecular weight of 238.14 g/mol. IUPAC name: [1,3]thiazolo[4,5-c]pyridin-2-ylmethanamine;dihydrochloride. InChIKey: LMHDUVDATDQBDU-UHFFFAOYSA-N.
| Molecular formula | C7H9Cl2N3S |
|---|---|
| Molecular weight | 238.14 g/mol |
| IUPAC name | [1,3]thiazolo[4,5-c]pyridin-2-ylmethanamine;dihydrochloride |
| InChIKey | LMHDUVDATDQBDU-UHFFFAOYSA-N |
| SMILES | C1=CN=CC2=C1SC(=N2)CN.Cl.Cl |
Computed by PubChem (NCBI)