Products 1810733-76-6
CAS 1810733-76-6 appears in our catalog under these names: Anticancer agent 149, Anticancer agent 149, ≥95%. Offered by: MedChemExpress, Chemat. Available pack sizes: 1 mg, 5 mg, 5mg.
3,4-dimethoxy-9,10-dihydrophenanthrene-2,5,6-triol (CAS 1810733-76-6) is a chemical compound with the molecular formula C16H16O5 and a molecular weight of 288.29 g/mol. IUPAC name: 3,4-dimethoxy-9,10-dihydrophenanthrene-2,5,6-triol. InChIKey: KTEWNCIIDZFOCY-UHFFFAOYSA-N.
| Molecular formula | C16H16O5 |
|---|---|
| Molecular weight | 288.29 g/mol |
| IUPAC name | 3,4-dimethoxy-9,10-dihydrophenanthrene-2,5,6-triol |
| InChIKey | KTEWNCIIDZFOCY-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C2CCC3=C(C2=C1OC)C(=C(C=C3)O)O)O |
Computed by PubChem (NCBI)
Synonyms:
Anticancer agent 149, orb1941681