Products 307548-90-9
CAS 307548-90-9 is the registry number for 2-[(6-Methyl-4-oxo-1,2,3,4-tetrahydrocyclopenta[c]chromen-7-yl)oxy]propanoic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
2-[(6-methyl-4-oxo-2,3-dihydro-1H-cyclopenta[c]chromen-7-yl)oxy]propanoic acid (CAS 307548-90-9) is a chemical compound with the molecular formula C16H16O5 and a molecular weight of 288.29 g/mol. IUPAC name: 2-[(6-methyl-4-oxo-2,3-dihydro-1H-cyclopenta[c]chromen-7-yl)oxy]propanoic acid. InChIKey: DWNZLQPWQLNPRS-UHFFFAOYSA-N.
| Molecular formula | C16H16O5 |
|---|---|
| Molecular weight | 288.29 g/mol |
| IUPAC name | 2-[(6-methyl-4-oxo-2,3-dihydro-1H-cyclopenta[c]chromen-7-yl)oxy]propanoic acid |
| InChIKey | DWNZLQPWQLNPRS-UHFFFAOYSA-N |
| SMILES | CC1=C(C=CC2=C1OC(=O)C3=C2CCC3)OC(C)C(=O)O |
Computed by PubChem (NCBI)