CAS 304896-83-1 is the registry number for [(3-Methyl-6-oxo-7,8,9,10-tetrahydro-6h-benzo[c]chromen-1-yl)oxy]acetic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
2-[(3-methyl-6-oxo-7,8,9,10-tetrahydrobenzo[c]chromen-1-yl)oxy]acetic acid (CAS 304896-83-1) is a chemical compound with the molecular formula C16H16O5 and a molecular weight of 288.29 g/mol. IUPAC name: 2-[(3-methyl-6-oxo-7,8,9,10-tetrahydrobenzo[c]chromen-1-yl)oxy]acetic acid. InChIKey: UOCZEAJIBFMNTF-UHFFFAOYSA-N.
| Molecular formula | C16H16O5 |
|---|---|
| Molecular weight | 288.29 g/mol |
| IUPAC name | 2-[(3-methyl-6-oxo-7,8,9,10-tetrahydrobenzo[c]chromen-1-yl)oxy]acetic acid |
| InChIKey | UOCZEAJIBFMNTF-UHFFFAOYSA-N |
| SMILES | CC1=CC2=C(C3=C(CCCC3)C(=O)O2)C(=C1)OCC(=O)O |
Computed by PubChem (NCBI)