Products 18111-03-0

CAS 18111-03-0 is the registry number for 3-(3-Hydroxy-4,5-dimethoxyphenyl) propanoic acid, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg.

Structural formula: {0} (CAS {1})

3-(3-hydroxy-4,5-dimethoxyphenyl)propanoic acid (CAS 18111-03-0) is a chemical compound with the molecular formula C11H14O5 and a molecular weight of 226.23 g/mol. IUPAC name: 3-(3-hydroxy-4,5-dimethoxyphenyl)propanoic acid. InChIKey: SLVLHPYLFRQJFV-UHFFFAOYSA-N.

Identity
Molecular formulaC11H14O5
Molecular weight226.23 g/mol
IUPAC name3-(3-hydroxy-4,5-dimethoxyphenyl)propanoic acid
InChIKeySLVLHPYLFRQJFV-UHFFFAOYSA-N
SMILESCOC1=CC(=CC(=C1OC)O)CCC(=O)O

Computed by PubChem (NCBI)