CAS 181137-41-7 is the registry number for SKP-451. Offered by: MedChemExpress. Available pack sizes: Get quote.
1-[(2S)-2-(1,3-dioxolan-2-yl)-2-methyl-6-nitrochromen-4-yl]pyrrolidin-2-one (CAS 181137-41-7) is a chemical compound with the molecular formula C17H18N2O6 and a molecular weight of 346.3 g/mol. IUPAC name: 1-[(2S)-2-(1,3-dioxolan-2-yl)-2-methyl-6-nitrochromen-4-yl]pyrrolidin-2-one. InChIKey: NJJPKIPOZSWUHV-KRWDZBQOSA-N.
| Molecular formula | C17H18N2O6 |
|---|---|
| Molecular weight | 346.3 g/mol |
| IUPAC name | 1-[(2S)-2-(1,3-dioxolan-2-yl)-2-methyl-6-nitrochromen-4-yl]pyrrolidin-2-one |
| InChIKey | NJJPKIPOZSWUHV-KRWDZBQOSA-N |
| SMILES | C[C@]1(C=C(C2=C(O1)C=CC(=C2)[N+](=O)[O-])N3CCCC3=O)C4OCCO4 |
Computed by PubChem (NCBI)