CAS 181306-08-1 appears in our catalog under these names: 3,4-Dimethyl 6-(dimethylamino)-2-methylpyridine-3,4-dicarboxylate, 95%, 3,4-Dimethyl 6-(dimethylamino)-2-methylpyridine-3,4-dicarboxylate. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
Dimethyl 6-(dimethylamino)-2-methylpyridine-3,4-dicarboxylate (CAS 181306-08-1) is a chemical compound with the molecular formula C12H16N2O4 and a molecular weight of 252.27 g/mol. IUPAC name: dimethyl 6-(dimethylamino)-2-methylpyridine-3,4-dicarboxylate. InChIKey: IILJJFMDQJHOKQ-UHFFFAOYSA-N.
| Molecular formula | C12H16N2O4 |
|---|---|
| Molecular weight | 252.27 g/mol |
| IUPAC name | dimethyl 6-(dimethylamino)-2-methylpyridine-3,4-dicarboxylate |
| InChIKey | IILJJFMDQJHOKQ-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=CC(=N1)N(C)C)C(=O)OC)C(=O)OC |
Computed by PubChem (NCBI)