CAS 181486-56-6 appears in our catalog under these names: rel-((1R,2R)-Cyclobutane-1,2-diyl)dimethanamine dihydrochloride, 98%, Lobaplatin Impurity 1 DiHCl. Offered by: Chemat Brand. Available pack sizes: on request.
[(1R,2R)-2-(aminomethyl)cyclobutyl]methanamine;dihydrochloride (CAS 181486-56-6) is a chemical compound with the molecular formula C6H16Cl2N2 and a molecular weight of 187.11 g/mol. IUPAC name: [(1R,2R)-2-(aminomethyl)cyclobutyl]methanamine;dihydrochloride. InChIKey: FCZGUISVPWFFBE-USPAICOZSA-N.
| Molecular formula | C6H16Cl2N2 |
|---|---|
| Molecular weight | 187.11 g/mol |
| IUPAC name | [(1R,2R)-2-(aminomethyl)cyclobutyl]methanamine;dihydrochloride |
| InChIKey | FCZGUISVPWFFBE-USPAICOZSA-N |
| SMILES | C1C[C@H]([C@@H]1CN)CN.Cl.Cl |
Computed by PubChem (NCBI)