CAS 206991-53-9 is the registry number for Lobaplatin Impurity 6 DiHCl. Offered by: Chemat Brand. Available pack sizes: on request.
[(1S,2R)-2-(aminomethyl)cyclobutyl]methanamine;dihydrochloride (CAS 206991-53-9) is a chemical compound with the molecular formula C6H16Cl2N2 and a molecular weight of 187.11 g/mol. IUPAC name: [(1S,2R)-2-(aminomethyl)cyclobutyl]methanamine;dihydrochloride. InChIKey: FCZGUISVPWFFBE-RUTFAPCESA-N.
| Molecular formula | C6H16Cl2N2 |
|---|---|
| Molecular weight | 187.11 g/mol |
| IUPAC name | [(1S,2R)-2-(aminomethyl)cyclobutyl]methanamine;dihydrochloride |
| InChIKey | FCZGUISVPWFFBE-RUTFAPCESA-N |
| SMILES | C1C[C@H]([C@H]1CN)CN.Cl.Cl |
Computed by PubChem (NCBI)