Products 1814934-91-2
CAS 1814934-91-2 is the registry number for 2-Phenyl-1,10-dihydroimidazo[4,5-a]carbazole 95%. Offered by: Ambeed. Available pack sizes: 100mg, 250mg, 1g, 5g.
2-phenyl-3,10-dihydroimidazo[4,5-a]carbazole (CAS 1814934-91-2) is a chemical compound with the molecular formula C19H13N3 and a molecular weight of 283.3 g/mol. IUPAC name: 2-phenyl-3,10-dihydroimidazo[4,5-a]carbazole. InChIKey: GAZFUSJBLFYITG-UHFFFAOYSA-N.
| Molecular formula | C19H13N3 |
|---|---|
| Molecular weight | 283.3 g/mol |
| IUPAC name | 2-phenyl-3,10-dihydroimidazo[4,5-a]carbazole |
| InChIKey | GAZFUSJBLFYITG-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=NC3=C(N2)C=CC4=C3NC5=CC=CC=C45 |
Computed by PubChem (NCBI)