Products 155885-64-6
CAS 155885-64-6 is the registry number for 1-(1H-indol-3-yl)-9H-pyrido(3,4-b)indole, 95-<97%. Offered by: Hoffman Fine Chemicals. Available pack sizes: 2,5g, 5g, 10g.
1-(1H-indol-3-yl)-9H-pyrido[3,4-b]indole (CAS 155885-64-6) is a chemical compound with the molecular formula C19H13N3 and a molecular weight of 283.3 g/mol. IUPAC name: 1-(1H-indol-3-yl)-9H-pyrido[3,4-b]indole. InChIKey: OGIMCDMIYGVEHU-UHFFFAOYSA-N.
| Molecular formula | C19H13N3 |
|---|---|
| Molecular weight | 283.3 g/mol |
| IUPAC name | 1-(1H-indol-3-yl)-9H-pyrido[3,4-b]indole |
| InChIKey | OGIMCDMIYGVEHU-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C3=C(N2)C(=NC=C3)C4=CNC5=CC=CC=C54 |
Computed by PubChem (NCBI)