CAS 67899-59-6 is the registry number for 2,3-Diphenylpyrido[3,4-b]pyrazine, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
2,3-diphenylpyrido[3,4-b]pyrazine (CAS 67899-59-6) is a chemical compound with the molecular formula C19H13N3 and a molecular weight of 283.3 g/mol. IUPAC name: 2,3-diphenylpyrido[3,4-b]pyrazine. InChIKey: NENQBISDXSLACH-UHFFFAOYSA-N.
| Molecular formula | C19H13N3 |
|---|---|
| Molecular weight | 283.3 g/mol |
| IUPAC name | 2,3-diphenylpyrido[3,4-b]pyrazine |
| InChIKey | NENQBISDXSLACH-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=NC3=C(C=NC=C3)N=C2C4=CC=CC=C4 |
Computed by PubChem (NCBI)