CAS 1232-99-1 is the registry number for 2,3-diphenylpyridino(3,2-b)pyrazine. Offered by: Biosynth. Available pack sizes: 250mg.
2,3-diphenylpyrido[2,3-b]pyrazine (CAS 1232-99-1) is a chemical compound with the molecular formula C19H13N3 and a molecular weight of 283.3 g/mol. IUPAC name: 2,3-diphenylpyrido[2,3-b]pyrazine. InChIKey: RBAXWBRRSJYIIW-UHFFFAOYSA-N.
| Molecular formula | C19H13N3 |
|---|---|
| Molecular weight | 283.3 g/mol |
| IUPAC name | 2,3-diphenylpyrido[2,3-b]pyrazine |
| InChIKey | RBAXWBRRSJYIIW-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=NC3=C(N=CC=C3)N=C2C4=CC=CC=C4 |
Computed by PubChem (NCBI)