CAS 181525-38-2 appears in our catalog under these names: 9-Hydroxy-3-(2-hydroxyethyl)-2-methyl-4H-pyrido(1,2-a)pyrimidin-4-one, >95% (HPLC), 9-hydroxy-3-(2-hydroxyethyl)-2-methyl-4H-pyrido[1,2-a]pyrimidin-4-one, 95%, 95%, Paliperidone Impurity 14. Offered by: TRC, Chemat, Hubei YoungXin, MedChemExpress. Available pack sizes: 250mg, 25mg, 100mg, 1g, 10mg, 50mg, 200mg, Get quote.
9-hydroxy-3-(2-hydroxyethyl)-2-methylpyrido[1,2-a]pyrimidin-4-one (CAS 181525-38-2) is a chemical compound with the molecular formula C11H12N2O3 and a molecular weight of 220.22 g/mol. IUPAC name: 9-hydroxy-3-(2-hydroxyethyl)-2-methylpyrido[1,2-a]pyrimidin-4-one. InChIKey: GNJWAVGJDQQQSS-UHFFFAOYSA-N.
| Molecular formula | C11H12N2O3 |
|---|---|
| Molecular weight | 220.22 g/mol |
| IUPAC name | 9-hydroxy-3-(2-hydroxyethyl)-2-methylpyrido[1,2-a]pyrimidin-4-one |
| InChIKey | GNJWAVGJDQQQSS-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=O)N2C=CC=C(C2=N1)O)CCO |
Computed by PubChem (NCBI)