Products 1816307-88-6

CAS 1816307-88-6 is the registry number for 1-Cyclopentyl-1H-indole, 95-<97%. Offered by: Hoffman Fine Chemicals. Available pack sizes: 5g, 10g, 25g.

Structural formula: {0} (CAS {1})

1-cyclopentylindole (CAS 1816307-88-6) is a chemical compound with the molecular formula C13H15N and a molecular weight of 185.26 g/mol. IUPAC name: 1-cyclopentylindole. InChIKey: MDODNOUCLHFLQZ-UHFFFAOYSA-N.

Identity
Molecular formulaC13H15N
Molecular weight185.26 g/mol
IUPAC name1-cyclopentylindole
InChIKeyMDODNOUCLHFLQZ-UHFFFAOYSA-N
SMILESC1CCC(C1)N2C=CC3=CC=CC=C32

Computed by PubChem (NCBI)