CAS 1817790-73-0 is the registry number for 1,1-Dimethylethyl (1R,4R,5R)-5-amino-2-azabicyclo[2.1.1]hexane-2-carboxylate, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 500mg.
Tert-butyl (1R,4R,5R)-5-amino-2-azabicyclo[2.1.1]hexane-2-carboxylate (CAS 1817790-73-0) is a chemical compound with the molecular formula C10H18N2O2 and a molecular weight of 198.26 g/mol. IUPAC name: tert-butyl (1R,4R,5R)-5-amino-2-azabicyclo[2.1.1]hexane-2-carboxylate. InChIKey: MVDURHAWUZLLLY-BWZBUEFSSA-N.
| Molecular formula | C10H18N2O2 |
|---|---|
| Molecular weight | 198.26 g/mol |
| IUPAC name | tert-butyl (1R,4R,5R)-5-amino-2-azabicyclo[2.1.1]hexane-2-carboxylate |
| InChIKey | MVDURHAWUZLLLY-BWZBUEFSSA-N |
| SMILES | CC(C)(C)OC(=O)N1C[C@H]2C[C@@H]1[C@@H]2N |
Computed by PubChem (NCBI)