Products 2165421-15-6
CAS 2165421-15-6 is the registry number for tert-Butyl (1R,4S,5S)-5-amino-2-azabicyclo[2.1.1]hexane-2-carboxylate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Tert-butyl (1R,4S,5S)-5-amino-2-azabicyclo[2.1.1]hexane-2-carboxylate (CAS 2165421-15-6) is a chemical compound with the molecular formula C10H18N2O2 and a molecular weight of 198.26 g/mol. IUPAC name: tert-butyl (1R,4S,5S)-5-amino-2-azabicyclo[2.1.1]hexane-2-carboxylate. InChIKey: MVDURHAWUZLLLY-RNJXMRFFSA-N.
| Molecular formula | C10H18N2O2 |
|---|---|
| Molecular weight | 198.26 g/mol |
| IUPAC name | tert-butyl (1R,4S,5S)-5-amino-2-azabicyclo[2.1.1]hexane-2-carboxylate |
| InChIKey | MVDURHAWUZLLLY-RNJXMRFFSA-N |
| SMILES | CC(C)(C)OC(=O)N1C[C@@H]2C[C@@H]1[C@H]2N |
Computed by PubChem (NCBI)