CAS 1817828-97-9 is the registry number for 3-Chloro-6-methyl-5-nitro-1,2-dihydropyridin-2-one. Offered by: Biosynth. Available pack sizes: 100mg, 1g.
3-chloro-6-methyl-5-nitro-1H-pyridin-2-one (CAS 1817828-97-9) is a chemical compound with the molecular formula C6H5ClN2O3 and a molecular weight of 188.57 g/mol. IUPAC name: 3-chloro-6-methyl-5-nitro-1H-pyridin-2-one. InChIKey: FLUALWYBEARFEP-UHFFFAOYSA-N.
| Molecular formula | C6H5ClN2O3 |
|---|---|
| Molecular weight | 188.57 g/mol |
| IUPAC name | 3-chloro-6-methyl-5-nitro-1H-pyridin-2-one |
| InChIKey | FLUALWYBEARFEP-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C(C(=O)N1)Cl)[N+](=O)[O-] |
Computed by PubChem (NCBI)