Products 1818292-89-5
CAS 1818292-89-5 is the registry number for 6-CHLORO-1H-PYRROLO[2,3-B]PYRIDINE-2,3-DIONE, 97%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g.
6-chloro-1H-pyrrolo[2,3-b]pyridine-2,3-dione (CAS 1818292-89-5) is a chemical compound with the molecular formula C7H3ClN2O2 and a molecular weight of 182.56 g/mol. IUPAC name: 6-chloro-1H-pyrrolo[2,3-b]pyridine-2,3-dione. InChIKey: OYCCXFOJXYCRID-UHFFFAOYSA-N.
| Molecular formula | C7H3ClN2O2 |
|---|---|
| Molecular weight | 182.56 g/mol |
| IUPAC name | 6-chloro-1H-pyrrolo[2,3-b]pyridine-2,3-dione |
| InChIKey | OYCCXFOJXYCRID-UHFFFAOYSA-N |
| SMILES | C1=CC(=NC2=C1C(=O)C(=O)N2)Cl |
Computed by PubChem (NCBI)