Products 18186-43-1
CAS 18186-43-1 appears in our catalog under these names: Serotonin beta-D-Glucuronide, >95% (HPLC), Serotonin β–D–Glucuronide, Serotonin β-D-glucuronide, Serotonin glucuronide, Serotonin-beta-D-glucuronide. Offered by: TRC, GLPBio, Biosynth, MedChemExpress, Supelco. Available pack sizes: 50mg, 5mg, 1mg, 10mg, 25mg, 5 mg, 1ML.
(2S,3S,4S,5R,6S)-6-[[3-(2-aminoethyl)-1H-indol-5-yl]oxy]-3,4,5-trihydroxyoxane-2-carboxylic acid (CAS 18186-43-1) is a chemical compound with the molecular formula C16H20N2O7 and a molecular weight of 352.34 g/mol. IUPAC name: (2S,3S,4S,5R,6S)-6-[[3-(2-aminoethyl)-1H-indol-5-yl]oxy]-3,4,5-trihydroxyoxane-2-carboxylic acid. InChIKey: QALKNDMLQRCLGT-JHZZJYKESA-N.
| Molecular formula | C16H20N2O7 |
|---|---|
| Molecular weight | 352.34 g/mol |
| IUPAC name | (2S,3S,4S,5R,6S)-6-[[3-(2-aminoethyl)-1H-indol-5-yl]oxy]-3,4,5-trihydroxyoxane-2-carboxylic acid |
| InChIKey | QALKNDMLQRCLGT-JHZZJYKESA-N |
| SMILES | C1=CC2=C(C=C1O[C@H]3[C@@H]([C@H]([C@@H]([C@H](O3)C(=O)O)O)O)O)C(=CN2)CCN |
Computed by PubChem (NCBI)