Products 181866-85-3

CAS 181866-85-3 is the registry number for 3-(Ethoxycarbonyl)-4-methyl-5-(1-oxopropyl)-2-furanpropanoic Acid Ethyl Ester. Offered by: TRC. Available pack sizes: 100mg, 10mg, 25mg.

Structural formula: {0} (CAS {1})

Ethyl 2-(3-ethoxy-3-oxopropyl)-4-methyl-5-propanoylfuran-3-carboxylate (CAS 181866-85-3) is a chemical compound with the molecular formula C16H22O6 and a molecular weight of 310.34 g/mol. IUPAC name: ethyl 2-(3-ethoxy-3-oxopropyl)-4-methyl-5-propanoylfuran-3-carboxylate. InChIKey: JYJCQPKLHPXHPJ-UHFFFAOYSA-N.

Identity
Molecular formulaC16H22O6
Molecular weight310.34 g/mol
IUPAC nameethyl 2-(3-ethoxy-3-oxopropyl)-4-methyl-5-propanoylfuran-3-carboxylate
InChIKeyJYJCQPKLHPXHPJ-UHFFFAOYSA-N
SMILESCCC(=O)C1=C(C(=C(O1)CCC(=O)OCC)C(=O)OCC)C

Computed by PubChem (NCBI)