CAS 605-54-9 appears in our catalog under these names: Bis(2-ethoxyethyl) phthalate, 98+%, Phthalic Acid,bis(2-ethoxyethyl) Ester, Bis(2-ethoxyethyl) Phthalate (>90%), Phthalic acid, bis-2-ethoxyethyl ester, Bis(2-ethoxyethyl) phthalate. Offered by: Chemat Brand, Hubei YoungXin, TRC, Dr. Ehrenstorfer, HPC Standards. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg, 1mg, 5mg.
Bis(2-ethoxyethyl) benzene-1,2-dicarboxylate (CAS 605-54-9) is a chemical compound with the molecular formula C16H22O6 and a molecular weight of 310.34 g/mol. IUPAC name: bis(2-ethoxyethyl) benzene-1,2-dicarboxylate. InChIKey: RMKYMNRQXYPJHL-UHFFFAOYSA-N.
| Molecular formula | C16H22O6 |
|---|---|
| Molecular weight | 310.34 g/mol |
| IUPAC name | bis(2-ethoxyethyl) benzene-1,2-dicarboxylate |
| InChIKey | RMKYMNRQXYPJHL-UHFFFAOYSA-N |
| SMILES | CCOCCOC(=O)C1=CC=CC=C1C(=O)OCCOCC |
Computed by PubChem (NCBI)