CAS 41826-92-0 appears in our catalog under these names: Trepibutone, Trepibutone/ 98.19% (existing batch purity), 4-Oxo-4-(2,4,5-triethoxyphenyl)butanoic acid, 99%, 99%, Trepibutone, 99.83%, Trepibutone (Standard). Offered by: Chemat Brand, TargetMol, GLPBio, Chemat, MedChemExpress. Available pack sizes: on request, 5mg, 10mg, 25mg, 50mg, 100mg, 200mg, 10mM (in 1ml dmso).
4-oxo-4-(2,4,5-triethoxyphenyl)butanoic acid (CAS 41826-92-0) is a chemical compound with the molecular formula C16H22O6 and a molecular weight of 310.34 g/mol. IUPAC name: 4-oxo-4-(2,4,5-triethoxyphenyl)butanoic acid. InChIKey: YPTFHLJNWSJXKG-UHFFFAOYSA-N.
| Molecular formula | C16H22O6 |
|---|---|
| Molecular weight | 310.34 g/mol |
| IUPAC name | 4-oxo-4-(2,4,5-triethoxyphenyl)butanoic acid |
| InChIKey | YPTFHLJNWSJXKG-UHFFFAOYSA-N |
| SMILES | CCOC1=CC(=C(C=C1C(=O)CCC(=O)O)OCC)OCC |
Computed by PubChem (NCBI)