CAS 1818843-16-1 is the registry number for tert-Butyl n-([(2r,4r)-4-fluoropyrrolidin-2-yl]methyl)carbamate hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g, 250mg.
Tert-butyl N-[[(2R,4R)-4-fluoropyrrolidin-2-yl]methyl]carbamate;hydrochloride (CAS 1818843-16-1) is a chemical compound with the molecular formula C10H20ClFN2O2 and a molecular weight of 254.73 g/mol. IUPAC name: tert-butyl N-[[(2R,4R)-4-fluoropyrrolidin-2-yl]methyl]carbamate;hydrochloride. InChIKey: ZFUOQMCJMKAZMC-SCLLHFNJSA-N.
| Molecular formula | C10H20ClFN2O2 |
|---|---|
| Molecular weight | 254.73 g/mol |
| IUPAC name | tert-butyl N-[[(2R,4R)-4-fluoropyrrolidin-2-yl]methyl]carbamate;hydrochloride |
| InChIKey | ZFUOQMCJMKAZMC-SCLLHFNJSA-N |
| SMILES | CC(C)(C)OC(=O)NC[C@H]1C[C@H](CN1)F.Cl |
Computed by PubChem (NCBI)