CAS 2231676-25-6 appears in our catalog under these names: tert-butyl N-[(3-fluoroazetidin-3-yl)methyl]-N-methyl-carbamate,hydrochloride, 97%, 97%, TERT-BUTYL N-[(3-FLUOROAZETIDIN-3-YL)METHYL]-N-METHYL-CARBAMATE HYDROCHLORIDE, 97%. Offered by: Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 500mg, 1g.
Tert-butyl N-[(3-fluoroazetidin-3-yl)methyl]-N-methylcarbamate;hydrochloride (CAS 2231676-25-6) is a chemical compound with the molecular formula C10H20ClFN2O2 and a molecular weight of 254.73 g/mol. IUPAC name: tert-butyl N-[(3-fluoroazetidin-3-yl)methyl]-N-methylcarbamate;hydrochloride. InChIKey: JZTJYNHJMAETET-UHFFFAOYSA-N.
| Molecular formula | C10H20ClFN2O2 |
|---|---|
| Molecular weight | 254.73 g/mol |
| IUPAC name | tert-butyl N-[(3-fluoroazetidin-3-yl)methyl]-N-methylcarbamate;hydrochloride |
| InChIKey | JZTJYNHJMAETET-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N(C)CC1(CNC1)F.Cl |
Computed by PubChem (NCBI)