CAS 2287282-20-4 is the registry number for rac-tert-Butyl N-{((1R,3R)-3-amino-1-fluorocyclobutyl)methyl}carbamate hydrochloride. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
Tert-butyl N-[(3-amino-1-fluorocyclobutyl)methyl]carbamate;hydrochloride (CAS 2287282-20-4) is a chemical compound with the molecular formula C10H20ClFN2O2 and a molecular weight of 254.73 g/mol. IUPAC name: tert-butyl N-[(3-amino-1-fluorocyclobutyl)methyl]carbamate;hydrochloride. InChIKey: WWXIZNVKQWBSOZ-UHFFFAOYSA-N.
| Molecular formula | C10H20ClFN2O2 |
|---|---|
| Molecular weight | 254.73 g/mol |
| IUPAC name | tert-butyl N-[(3-amino-1-fluorocyclobutyl)methyl]carbamate;hydrochloride |
| InChIKey | WWXIZNVKQWBSOZ-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NCC1(CC(C1)N)F.Cl |
Computed by PubChem (NCBI)