CAS 18189-42-9 is the registry number for 3-(Ethoxycarbonyl)benzoic acid. Offered by: Biosynth. Available pack sizes: 2,5g.
3-ethoxycarbonylbenzoic acid (CAS 18189-42-9) is a chemical compound with the molecular formula C10H10O4 and a molecular weight of 194.18 g/mol. IUPAC name: 3-ethoxycarbonylbenzoic acid. InChIKey: HOPNITFHNCUXTG-UHFFFAOYSA-N.
| Molecular formula | C10H10O4 |
|---|---|
| Molecular weight | 194.18 g/mol |
| IUPAC name | 3-ethoxycarbonylbenzoic acid |
| InChIKey | HOPNITFHNCUXTG-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=CC=CC(=C1)C(=O)O |
Computed by PubChem (NCBI)