Products 181954-49-4
CAS 181954-49-4 is the registry number for Methyl 5-Bromo-1-methyl-6-oxo-1,6-dihydropyridine-2-carboxylate, ≥95%, ≥95%. Offered by: Chemat. Available pack sizes: 100mg, 1g.
Methyl 5-bromo-1-methyl-6-oxopyridine-2-carboxylate (CAS 181954-49-4) is a chemical compound with the molecular formula C8H8BrNO3 and a molecular weight of 246.06 g/mol. IUPAC name: methyl 5-bromo-1-methyl-6-oxopyridine-2-carboxylate. InChIKey: HZCKSRGQYNGBTL-UHFFFAOYSA-N.
| Molecular formula | C8H8BrNO3 |
|---|---|
| Molecular weight | 246.06 g/mol |
| IUPAC name | methyl 5-bromo-1-methyl-6-oxopyridine-2-carboxylate |
| InChIKey | HZCKSRGQYNGBTL-UHFFFAOYSA-N |
| SMILES | CN1C(=CC=C(C1=O)Br)C(=O)OC |
Computed by PubChem (NCBI)